| Name |
Cadinene (-)-beta-Cadinene |
| Formula |
C15H28 |
| Mw |
208.21910089 |
| CAS RN |
483-73-8 |
| C_ID |
C00052446
|
| InChIKey |
FZZNNPQZDRVKLU-YTFOTSKYSA-N |
| InChICode |
InChI=1S/C15H28/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h10-15H,5-9H2,1-4H3/t11-,12-,13-,14-,15-/m0/s1 |
| SMILES |
CC(C)[C@@H]1CC[C@H](C)[C@@H]2CC[C@H](C)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|