| Name |
Taraxerol acetate |
| Formula |
C32H52O2 |
| Mw |
468.3967309 |
| CAS RN |
2189-80-2 |
| C_ID |
C00032288
, 
|
| InChIKey |
YWJGYBXHXATAQY-GLUMBPBWNA-N |
| InChICode |
InChI=1S/C32H52O2/c1-21(33)34-26-13-17-30(7)22(28(26,4)5)11-15-31(8)23-10-14-29(6)19-18-27(2,3)20-25(29)32(23,9)16-12-24(30)31/h10,22,24-26H,11-20H2,1-9H3/t22-,24+,25+,26-,29-,30-,31-,32+/m0/s1 |
| SMILES |
CC(=O)OC1CC[C@]2(C)[C@H]3CC[C@]4(C)C(=CC[C@@]5(C)CCC(C)(C)C[C@H]54)[C@]3(C)CC[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Acanthopanax trifoliatus  | Ref. |
| Plantae | Asteraceae | Koelpinia linearis | Ref. |
| Plantae | Asteraceae | Pluchea sericea | Ref. |
| Plantae | Asteraceae | Xanthium canadense Mill. | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis clematidea  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
| Plantae | Euphorbiaceae | Euphorbia stygiana | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Rosaceae | Physocarpus capitatus | Ref. |
|
|
zoom in
| Organism | Salvia virgata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|