| Name |
(+)-Pseudoephedrine D-pseudoephedrine Pseudoephedrine trans-Ephedrine |
| Formula |
C10H15NO |
| Mw |
165.11536411 |
| CAS RN |
90-82-4 |
| C_ID |
C00031097
, 
|
| InChIKey |
KWGRBVOPPLSCSI-MNLQIPBYNA-N |
| InChICode |
InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1 |
| SMILES |
CN[C@@H](C)[C@@H](O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra ciliata SAM. | Ref. |
| Plantae | Ephedraceae | Ephedra distachya L.  | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina Bge.  | Ref. |
| Plantae | Ephedraceae | Ephedra gerardiana  | Ref. |
| Plantae | Ephedraceae | Ephedra intermedia  | Ref. |
| Plantae | Ephedraceae | Ephedra nebrodensis | Ref. |
| Plantae | Ephedraceae | Ephedra procera var.chrysocarpa. | Ref. |
| Plantae | Ephedraceae | Ephedra sinca | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Ephedraceae | Ephedra spp. | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
| Plantae | Papaveraceae | Roemeria refracta  | Ref. |
|
|
zoom in
| Organism | Sida rhombifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|