| Name |
3-Hydroxy-4-methoxybenzoic acid Isovanillic acid |
| Formula |
C8H8O4 |
| Mw |
168.04225874 |
| CAS RN |
645-08-9 |
| C_ID |
C00029502
, 
|
| InChIKey |
LBKFGYZQBSGRHY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11) |
| SMILES |
COc1ccc(C(=O)O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Asteraceae | Anthemis melanolepis | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Euphorbiaceae | Endospermum chinense | Ref. |
| Plantae | Fabaceae | Acacia confusa | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Moraceae | Ficus microcarpa  | Ref. |
| Plantae | Moraceae | Treculia obovoidea | Ref. |
| Plantae | Rutaceae | Citrus changshan-huyou | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
|
|
zoom in
| Organism | Scrophularia frutescens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|