| Name |
7-Angeloylretronecine 7-Angelylretronecine O-7-Angelylretronecine Retronecine 7-(2-methylcrotonate) |
| Formula |
C13H19NO3 |
| Mw |
237.13649348 |
| CAS RN |
6029-82-9 |
| C_ID |
C00026169
, 
|
| InChIKey |
TYGYPIIOOQNWBU-MFGPRIKCNA-N |
| InChICode |
InChI=1S/C13H19NO3/c1-3-9(2)13(16)17-11-5-7-14-6-4-10(8-15)12(11)14/h3-4,11-12,15H,5-8H2,1-2H3/b9-3-/t11-,12-/m1/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@@H]1CCN2CC=C(CO)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptococcaceae | Streptococcus macedonicus | Ref. |
| Plantae | Asteraceae | Pittocaulon filare | Ref. |
| Plantae | Asteraceae | Senecio inornatus | Ref. |
| Plantae | Asteraceae | Senecio triangularis Hook | Ref. |
| Plantae | Boraginaceae | Arnebia decumbens | Ref. |
| Plantae | Boraginaceae | Echium glomeratum | Ref. |
| Plantae | Boraginaceae | Echium horridum | Ref. |
| Plantae | Boraginaceae | Echium rauwolfii | Ref. |
| Plantae | Boraginaceae | Echium setosum | Ref. |
| Plantae | Boraginaceae | Echium vulgare  | Ref. |
| Plantae | Boraginaceae | Heliotropium bursiferum | Ref. |
| Plantae | Boraginaceae | Symphytum tuberosum | Ref. |
|
|
zoom in
| Organism | Heliotropium bursiferum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|