| Name |
beta-Cedrene (+)-beta-Cedrene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
546-28-1 |
| C_ID |
C00021720
, 
|
| InChIKey |
DYLPEFGBWGEFBB-VUERYHJANA-N |
| InChICode |
InChI=1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1 |
| SMILES |
C=C1CC[C@@]23C[C@@H]1C(C)(C)[C@@H]2CC[C@H]3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Jubulaceae | Frullania squarrosula | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
|
|
zoom in
| Organism | Salix babylonica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|