| Name |
Cynodontin 1,4,5,8-Tetrahydroxy-2-methylanthraquinone 2,5,7-trihydroxyemodin |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
476-43-7 |
| C_ID |
C00018258
, 
|
| InChIKey |
NFQXCHAJWVRYND-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c1-5-4-8(18)11-12(13(5)19)15(21)10-7(17)3-2-6(16)9(10)14(11)20/h2-4,16-19H,1H3 |
| SMILES |
Cc1cc(O)c2c(c1O)C(=O)c1c(O)ccc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Incertae sedis | Pyrenochaeta terrestris | Ref. |
| Fungi | Pleosporaceae | Curvularia geniculata | Ref. |
| Fungi | Pleosporaceae | Curvularia lunata NRRL 2380 | Ref. |
| Fungi | Pleosporaceae | Curvularia ramosa | Ref. |
| Fungi | Pleosporaceae | Curvularia trifolii | Ref. |
| Fungi | Pleosporaceae | Drechslera dematioidea | Ref. |
| Fungi | Pleosporaceae | Drechslera halodes | Ref. |
| Fungi | Pleosporaceae | Drechslera setariae | Ref. |
| Fungi | Pleosporaceae | Drechslera sorokiniana | Ref. |
| Fungi | Pleosporaceae | Drechslera spicifera | Ref. |
| Plantae | Rhamnaceae | Rhamnus wightii  | Ref. |
|
|
zoom in
| Organism | Rhamnus wightii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|