| Name |
Carpachromene 5-Hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one 5,4'-Dihidroxy-6'',6''-dimethylpyrano[2'',3'':7,6]flavone |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
57498-96-1 |
| C_ID |
C00013432
, 
|
| InChIKey |
YXOATFKTEDZPFL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O5/c1-20(2)8-7-13-16(25-20)10-17-18(19(13)23)14(22)9-15(24-17)11-3-5-12(21)6-4-11/h3-10,21,23H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc3oc(-c4ccc(O)cc4)cc(=O)c3c2O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Lonchocarpus xuul | Ref. |
| Plantae | Fabaceae | Lonchocarpus yucatanensis | Ref. |
| Plantae | Moraceae | Artocarpus bracteata Hook. | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Dorstenia kameruniana | Ref. |
| Plantae | Moraceae | Ficus formosana | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
| Plantae | Rutaceae | Atalantia monophylla  | Ref. |
| Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
| Plantae | Rutaceae | Pamburus missions | Ref. |
|
|
zoom in
| Organism | Pamburus missions | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Dreyer,Phytochem.,14,(1975),1617 |
|---|
|