| Name |
Calycosin Cyclosin 3'-Hydroxyformononetin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
20575-57-9 |
| C_ID |
C00009389
, 
|
| InChIKey |
ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)ccc3c2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bowdichia nitida | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Machaerium mucronulatum | Ref. |
| Plantae | Fabaceae | Machaerium vestitum | Ref. |
| Plantae | Fabaceae | Machaerium villosum | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Millettia laurentii | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Psorothamnus arborescens | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora fraseri | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
|
|
zoom in
| Organism | Machaerium villosum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Markham,Phytochem.,7,(1968),791 |
|---|
|