| Name |
Lupinifolin |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
55890-27-2 |
| C_ID |
C00008262
, 
|
| InChIKey |
PDTJZCUQXSFLDW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)5-10-18-23-17(11-12-25(3,4)30-23)22(28)21-19(27)13-20(29-24(18)21)15-6-8-16(26)9-7-15/h5-9,11-12,20,26,28H,10,13H2,1-4H3/t20-/m0/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1OC(c1ccc(O)cc1)CC3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Deguelia hatschbachii | Ref. |
| Plantae | Fabaceae | Derris hainesiana | Ref. |
| Plantae | Fabaceae | Erythrina fusca  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Flemingia macrophylla  | Ref. |
| Plantae | Fabaceae | Flemingia wallichii | Ref. |
| Plantae | Fabaceae | Lonchocarpus guatemalensis | Ref. |
| Plantae | Fabaceae | Lonchocarpus miniflorus | Ref. |
| Plantae | Fabaceae | Mundulea sericea  | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Tephrosia lupinifolia | Ref. |
|
|
zoom in
| Organism | Tephrosia lupinifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 369,Flavanones and dihydroflavonols
Smallberger,Tetrahedron,30,(1974),3927 |
|---|
|