| Name |
Phloretin |
| Formula |
C15H14O5 |
| Mw |
274.08412356 |
| CAS RN |
60-82-2 |
| C_ID |
C00007936
, 
|
| InChIKey |
VGEREEWJJVICBM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| SMILES |
O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum splendidum | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
| Plantae | Ericaceae | Pieris japonica  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Populus trichocarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Bohlmann,Phytochem.,18,(1979),885
English,Phytochem.,30,(1991),531 |
|---|
|