| Name |
Malvidin 3-rutinoside-5-glucoside |
| Formula |
C35H45O21 |
| Mw |
801.2453335 |
| CAS RN |
68736-45-8 |
| C_ID |
C00006745
, 
|
| InChIKey |
JCSRMPOVJLVJEB-GOMDGVDRNA-O |
| InChICode |
InChI=1S/C35H44O21/c1-11-22(38)26(42)29(45)33(51-11)50-10-21-25(41)28(44)31(47)35(56-21)54-19-8-14-15(52-32(19)12-4-17(48-2)23(39)18(5-12)49-3)6-13(37)7-16(14)53-34-30(46)27(43)24(40)20(9-36)55-34/h4-8,11,20-22,24-31,33-36,38,40-47H,9-10H2,1-3H3,(H-,37,39)/p+1/t11-,20+,21+,22-,24+,25+,26-,27-,28-,29-,30-,31+,33+,34+,35+/m0/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3cc2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dumasia truncata | Ref. |
| Plantae | Fabaceae | Vicia villosa  | Ref. |
| Plantae | Gesneriaceae | Saintpaulia ionantha | Ref. |
| Plantae | Gesneriaceae | Streptocarpus dunnii | Ref. |
| Plantae | Oleaceae | Ligustrum amurense | Ref. |
| Plantae | Oleaceae | Ligustrum sinense | Ref. |
| Plantae | Oleaceae | Ligustrum vulgare  | Ref. |
| Plantae | Oxalidaceae | Oxalis triangularis | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Vitaceae | Parthenocissus tricuspidata | Ref. |
|
|
zoom in
| Organism | Parthenocissus tricuspidata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85
Akavia,Z.Naturforsch.C.,36,(1981),378 |
|---|
|