| Name |
Kaempferol 3-O-beta-D-(6''-E-p-coumaroyl)glucopyranoside Tiliroside Kaempferol 3-O-beta-D-(6''-coumaroyl)-glucopyranoside Potengriffioside A |
| Formula |
C30H26O13 |
| Mw |
594.13734092 |
| CAS RN |
20316-62-5 |
| C_ID |
C00005851
, 
|
| InChIKey |
DVGGLGXQSFURLP-PMXORBILNA-N |
| InChICode |
InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26-,27-,30+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Aerva lanata  | Ref. |
| Plantae | Asteraceae | Anaphalis contorta Hooker  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Cistaceae | Helianthemum glomeratum | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Elaeagnaceae | Shepherdia argentea  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fagaceae | Quercus ilex  | Ref. |
| Plantae | Fagaceae | Quercus suber  | Ref. |
| Plantae | Labiatae | Leonurus heterophyllus  | Ref. |
| Plantae | Labiatae | Phlomis spectabilis | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Malvaceae | Colona auriculata  | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Malvaceae | Tilia argentea | Ref. |
| Plantae | Malvaceae | Tilia spp.  | Ref. |
| Plantae | Melastomataceae | Miconia cabucu | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pinus contorta  | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Rosaceae | Fragaria ananassa  | Ref. |
| Plantae | Rosaceae | Polylepis incana | Ref. |
| Plantae | Rosaceae | Potentilla anserina  | Ref. |
| Plantae | Rosaceae | Potentilla griffithii var.velutina | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Sparuna apiosyce | Ref. |
|
|
zoom in
| Organism | Phlomis spectabilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Higuchi,Phytochem.,17,(1978),787
Vermes,Helv.Chim.Acta,64,(1981),1964 |
|---|
|