| Name |
Gossypetin 7-glucoside |
| Formula |
C21H20O13 |
| Mw |
480.09039073 |
| CAS RN |
489-34-9 |
| C_ID |
C00005688
, 
|
| InChIKey |
ATRBFJXIWFCIMW-IYJXHOEWNA-N |
| InChICode |
InChI=1S/C21H20O13/c22-5-11-13(26)16(29)18(31)21(33-11)32-10-4-9(25)12-15(28)17(30)19(34-20(12)14(10)27)6-1-2-7(23)8(24)3-6/h1-4,11,13,16,18,21-27,29-31H,5H2/t11-,13+,16-,18+,21+/m0/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysanthemum segetum  | Ref. |
| Plantae | Asteraceae | Leucanthemopsis flaveola | Ref. |
| Plantae | Equisetaceae | Equisetum spp. | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus spp. | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Restionaceae | Calorophus lateriflorus | Ref. |
| Plantae | Restionaceae | Calorophus minor | Ref. |
| Plantae | Restionaceae | Restio complanatus | Ref. |
| Plantae | Restionaceae | Restio tetraphyllus | Ref. |
|
|
zoom in
| Organism | Restio complanatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Geissman,J.Org.Chem.,22,(1957),946
Kutney,Phytochem.,10,(1971),3287 |
|---|
|