| Name |
Rhamnetin 3-glucoside
Rhamnetin 3-O-beta-glucopyranoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
27875-34-9 |
| C_ID |
C00005506
|
| InChIKey |
PYVGIWNMMFJXFU-LFXZADKFSA-N |
| InChICode |
InChI=1S/C22H22O12/c23-6-8-3-12(27)15-13(4-8)32-20(9-1-2-10(25)11(26)5-9)21(17(15)29)34-22-19(31)18(30)16(28)14(7-24)33-22/h1-5,14,16,18-19,22-28,30-31H,6-7H2/t14-,16-,18+,19-,22+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(CO)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula spp. | Ref. |
| Plantae | Capparaceae | Boscia salicifolia | Ref. |
| Plantae | Chenopodiaceae | Chenopodium fremontii | Ref. |
| Plantae | Dilleniaceae | Dillenia pentagyna | Ref. |
| Plantae | Ericaceae | Pyrola chlorantha | Ref. |
| Plantae | Ericaceae | Pyrola virens | Ref. |
| Plantae | Fabaceae | Cassia sophora | Ref. |
| Plantae | Loranthaceae | Loranthus europaeus | Ref. |
| Plantae | Menyanthaceae | Nymphoides spp. | Ref. |
| Plantae | Poaceae | Phragmites australis | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum | Ref. |
|
|
zoom in
| Organism | Nymphoides spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nuralieva,Khim.Prir.Soedin.,5,(1969),369
Harvela,J.Nat.Prod.,47,(1984),1054 |
|---|
|
