| Name |
Quercetin 3-gentiobioside |
| Formula |
C27H30O17 |
| Mw |
626.14829954 |
| CAS RN |
7431-83-6 |
| C_ID |
C00005411
, 
|
| InChIKey |
FDRQPMVGJOQVTL-AVNJKGJRNA-N |
| InChICode |
InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)40-7-15-18(34)21(37)23(39)27(43-15)44-25-19(35)16-12(32)4-9(29)5-13(16)41-24(25)8-1-2-10(30)11(31)3-8/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20+,21-,22-,23+,26-,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aspleniaceae | Ceterach officinarum  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus canadensis  | Ref. |
| Plantae | Fabaceae | Acacia raddiana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Vigna spp. | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Polemoniaceae | Linanthus spp. | Ref. |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Primulaceae | Primula sinensis | Ref. |
| Plantae | Resedaceae | Ochradenus baccatus  | Ref. |
| Plantae | Rosaceae | Cotoneaster oligantha | Ref. |
| Plantae | Rosaceae | Sorbus pendula | Ref. |
| Plantae | Rosaceae | Sorbus quercifolia | Ref. |
| Plantae | Zygophyllaceae | Tribulus spp. | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Linanthus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Bicochem.J.,78,(1961),298
Wagner,Chem.Ber.,101,(1968),3419 |
|---|
|