| Name |
5,7,4'-Trihydroxy-3,8,3'-trimethoxyflavone Gossypetin 3,8,3'-trimethyl ether 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
14965-08-3 |
| C_ID |
C00004735
, 
|
| InChIKey |
XZGZRRSEIISPEP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)15-18(25-3)14(22)13-10(20)7-11(21)16(24-2)17(13)26-15/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Encelia densifolia | Ref. |
| Plantae | Asteraceae | Enceliopsis nudicaulis | Ref. |
| Plantae | Asteraceae | Geraea canescens | Ref. |
| Plantae | Asteraceae | Gutierrezia spp. | Ref. |
| Plantae | Asteraceae | Haplopappus deserticola  | Ref. |
| Plantae | Asteraceae | Heteromma simplicifolium | Ref. |
| Plantae | Asteraceae | Psiadia trinervia | Ref. |
| Plantae | Calceolariaceae | Calceolaria salicifolia | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Cleomaceae | Polanisia trachysperma | Ref. |
| Plantae | Labiatae | Cyanostegia angustifolia | Ref. |
| Plantae | Labiatae | Cyanostegia microphylla | Ref. |
| Plantae | Rutaceae | Boronia coerulescens | Ref. |
| Plantae | Zygophyllaceae | Fagonia bruguieri  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Cyanostegia angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ghisalberti,Aust.J.Chem.,20,(1967),1049
Horie,Phytochem.,27,(1988),1491 |
|---|
|