| Name |
5,7,3',4'-Tetrahydroxyflavone 4'-beta-D-glucopyranoside Luteolin 4'-O-beta-D-glucopyranoside Luteolin 4'-glucoside Juncein Luteolin-4'-O-glucoside Luteolin-4'-O-beta-D-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
6920-38-3 |
| C_ID |
C00004276
, 
|
| InChIKey |
UHNXUSWGOJMEFO-CFBYCNAUNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19-,20+,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Trachelospermum jasminoides | Ref. |
| Plantae | Asteraceae | Gnaphalium affine  | Ref. |
| Plantae | Asteraceae | Helichrysum graveolen | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Bauhinia tarapotensis | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Kummerowia striata  | Ref. |
| Plantae | Fabaceae | Lathyrus pratensis | Ref. |
| Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Solanaceae | Physalis alkekengi var. franchetii  | Ref. |
| Plantae | Uvulariaceae | Disporum cantoniense | Ref. |
|
|
zoom in
| Organism | Spartium junceum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Spada,Gazz,Chim.Ital.,88,(1958),204
Williams,Phytochem.,34,(1993),197 |
|---|
|