| Name |
Desmethoxysudachitin 5,7,4'-Trihydroxy-6,8-dimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
4323-80-2 |
| C_ID |
C00003876
, 
|
| InChIKey |
SYGUVOLSUJYPPS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-16-13(20)12-10(19)7-11(8-3-5-9(18)6-4-8)24-15(12)17(23-2)14(16)21/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1c(O)c(OC)c2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Madia capitata | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Scutellaria repens | Ref. |
| Plantae | Pteridaceae | Cheilanthes argentea | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
|
|
zoom in
| Organism | Gardenia lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Horie, J.Chem.Soc.Jpn,83,(1962),602
Wollenweber,J.Plant Physiol.,131,(1987),37 |
|---|
|