| Name |
Columbin |
| Formula |
C20H22O6 |
| Mw |
358.14163844 |
| CAS RN |
546-97-4 |
| C_ID |
C00003417
, 
|
| InChIKey |
AALLCALQGXXWNA-SQVOLJDCNA-N |
| InChICode |
InChI=1S/C20H22O6/c1-18-9-14(11-5-8-24-10-11)25-16(21)12(18)3-6-19(2)15(18)13-4-7-20(19,23)17(22)26-13/h4-5,7-8,10,12-15,23H,3,6,9H2,1-2H3/t12-,13?,14+,15-,18+,19+,20-/m0/s1 |
| SMILES |
C[C@@]12C[C@H](c3ccoc3)OC(=O)[C@@H]1CC[C@]1(C)[C@H]2[C@H]2C=C[C@]1(O)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Calystegia hedracea | Ref. |
| Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr.  | Ref. |
| Plantae | Menispermaceae | Dioscoreophyllum cummingsii | Ref. |
| Plantae | Menispermaceae | Dioscoreophyllum cumminsii | Ref. |
| Plantae | Menispermaceae | Jateorhiza palmata  | Ref. |
| Plantae | Menispermaceae | Tinospora capillipes | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| Plantae | Menispermaceae | Tinospora dentata | Ref. |
| Plantae | Menispermaceae | Tinospora sagittata  | Ref. |
| Plantae | Solanaceae | Solanum dulcamara  | Ref. |
| Plantae | Solanaceae | Solanum lyratum  | Ref. |
|
|
zoom in
| Organism | Solanum lyratum | | Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|