| Name |
Rhaponticin
Rhaponthin
4'-Methoxy-3,3',5-trihydroxystilbene 3-O-beta-D-glucopyranoside |
| Formula |
C21H24O9 |
| Mw |
420.14203237 |
| CAS RN |
155-58-8 |
| C_ID |
C00002904
, 
|
| InChIKey |
GKAJCVFOJGXVIA-WJSKYKFWNA-N |
| InChICode |
InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18+,19-,20-,21+/m0/s1 |
| SMILES |
COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Guibourtia coleosperma | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
| Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum | Ref. |
| Plantae | Polygonaceae | Rheum altaicum | Ref. |
| Plantae | Polygonaceae | Rheum collineanum | Ref. |
| Plantae | Polygonaceae | Rheum cordatum | Ref. |
| Plantae | Polygonaceae | Rheum emodi | Ref. |
| Plantae | Polygonaceae | Rheum officinale | Ref. |
| Plantae | Polygonaceae | Rheum palmatum | Ref. |
| Plantae | Polygonaceae | Rheum rhaponticum | Ref. |
| Plantae | Polygonaceae | Rheum undulatum | Ref. |
|
|
zoom in
| Organism | Rheum officinale |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Aburjai, et al., Phytochemistry, 55, (2000), 407 |
|---|
|
