| Name |
Labiatenic acid Rosmarinic acid |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
20283-92-5 |
| C_ID |
C00002770
, 
|
| InChIKey |
DOUMFZQKYFQNTF-LBOXRDHUNA-N |
| InChICode |
InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+/t16-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anethum spp. | Ref. |
| Plantae | Apiaceae | Astrantia major  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum spp. | Ref. |
| Plantae | Apiaceae | Sanicula europaea  | Ref. |
| Plantae | Apiaceae | Sanicula spp. | Ref. |
| Plantae | Araceae | Anthurium versicolor | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Araliaceae | Hedera helix  | Ref. |
| Plantae | Boraginaceae | Lindelofia stylosa | Ref. |
| Plantae | Boraginaceae | Lithospermum ruderale | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Momordica balsamina  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Labiatae | Agastache rugosa  | Ref. |
| Plantae | Labiatae | Clinopodium chinense var. parviflorum | Ref. |
| Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Nepeta cadmea | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta.  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia bowleyana | Ref. |
| Plantae | Labiatae | Salvia cavaleriei | Ref. |
| Plantae | Labiatae | Salvia chinensis | Ref. |
| Plantae | Labiatae | Salvia flava  | Ref. |
| Plantae | Labiatae | Salvia lavandulifolia  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia prionitis  | Ref. |
| Plantae | Labiatae | Salvia sonchifolia | Ref. |
| Plantae | Labiatae | Salvia yunnanensis | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Teucrium scorodonia  | Ref. |
| Plantae | Labiatae | Thymus austriacus | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus citriodorus  | Ref. |
| Plantae | Labiatae | Thymus longicaulis  | Ref. |
| Plantae | Labiatae | Thymus oblongifolius | Ref. |
| Plantae | Labiatae | Thymus praecox  | Ref. |
| Plantae | Labiatae | Thymus pulegioides  | Ref. |
| Plantae | Labiatae | Thymus serpyllum  | Ref. |
| Plantae | Labiatae | Thymus sibthorpii | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Coleus forskohlii | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Apeiba tibourbou  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Malvaceae | Helicteres isora  | Ref. |
| Plantae | Malvaceae | Helicteres isora L.  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Rubiaceae | Hamelia patens  | Ref. |
| Plantae | Salviniaceae | Salvinia molesta | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| Plantae | Zosteraceae | Zostera noltii | Ref. |
| - | - | Robdosia coetsa | Ref. |
|
|
zoom in
| Organism | Lindelofia stylosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kitajima, et al., Chem Pharm Bull, 52, (2004), 1013.
CHOUDHARY, et al., Chem Pharm Bull, 53, (2005), 1469.
Lin, et al., Journal of Natural Products, 65, (2002), 745.
Janicsak, et al., Planta Med, 69, (2003), 1156.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|