| Name |
Piperonal |
| Formula |
C8H6O3 |
| Mw |
150.03169406 |
| CAS RN |
120-57-0 |
| C_ID |
C00002666
, 
|
| InChIKey |
SATCULPHIDQDRE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H6O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H,5H2 |
| SMILES |
O=Cc1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Eryngium potericum | Ref. |
| Plantae | Asteraceae | Baccharis rosmarinifolia | Ref. |
| Plantae | Boraginaceae | Heliotropium spp. | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Monimiaceae | Doryphora sassafras | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea | Ref. |
| Plantae | Orchidaceae | Vanilla spp. | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
| Plantae | Rubiaceae | Galium verum  | Ref. |
| Plantae | Violaceae | Viola spp. | Ref. |
|
|
zoom in
| Organism | Galium verum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|