| Name |
Tephrosin |
| Formula |
C23H22O7 |
| Mw |
410.13655306 |
| CAS RN |
76-80-2 |
| C_ID |
C00002578
, 
|
| InChIKey |
AQBZCCQCDWNNJQ-UUSWMZEJNA-N |
| InChICode |
InChI=1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3 |
| SMILES |
COc1cc2c(cc1OC)[C@]1(O)C(=O)c3ccc4c(c3O[C@@H]1CO2)C=CC(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Fabaceae | Crotalaria spp. | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Derris trifoliata  | Ref. |
| Plantae | Fabaceae | Lonchocarpus longifolius | Ref. |
| Plantae | Fabaceae | Lonchocarpus spp. | Ref. |
| Plantae | Fabaceae | Lonchocarpus spruceanus | Ref. |
| Plantae | Fabaceae | Millettia dura | Ref. |
| Plantae | Fabaceae | Millettia ferruginea  | Ref. |
| Plantae | Fabaceae | Millettia oblata ssp. teitensis  | Ref. |
| Plantae | Fabaceae | Millettia taiwaniana | Ref. |
| Plantae | Fabaceae | Mundulea sericea  | Ref. |
| Plantae | Fabaceae | Piscidia mollois | Ref. |
| Plantae | Fabaceae | Tephrosia elata  | Ref. |
| Plantae | Fabaceae | Tephrosia spp. | Ref. |
| - | - | Milletia dura | Ref. |
|
|
zoom in
| Organism | Millettia ferruginea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
ClarkJ.Am.Chem.Soc.,53,(1931),729
Delfel,J.Assoc.Off.Anal.Chem.,52,(1969),182 |
|---|
|