| Name |
Rotenone Tubotoxin Nicouline |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
83-79-4 |
| C_ID |
C00002568
, 
|
| InChIKey |
JUVIOZPCNVVQFO-BXPNWFCHNA-N |
| InChICode |
InChI=1S/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20-,21+/m1/s1 |
| SMILES |
C=C(C)[C@H]1Cc2c(ccc3c2O[C@@H]2COc4cc(OC)c(OC)cc4[C@@H]2C3=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Derris eclipta | Ref. |
| Plantae | Fabaceae | Derris elliptica  | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris trifoliata  | Ref. |
| Plantae | Fabaceae | Lonchocarpus spp. | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Millettia pervilleana | Ref. |
| Plantae | Fabaceae | Millettia reticulata  | Ref. |
| Plantae | Fabaceae | Millettia spp. | Ref. |
| Plantae | Fabaceae | Pachyrhizus erosus  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Piscidia piscipula  | Ref. |
| Plantae | Fabaceae | Tephrosia interrupta Engl.  | Ref. |
| Plantae | Fabaceae | Tephrosia linearis (Willd.) Pers.  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia spp. | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| - | - | Leguminosae | Ref. |
| - | - | Milletia pachycarpa | Ref. |
| - | - | Papilionoideae | Ref. |
|
|
zoom in
| Organism | Millettia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Krukoff,Am.J.Bot.,24,(1937),573
Delfel,J.Assoc.Off.Anal.Chem.,52,(1969),182 |
|---|
|