| Name |
Irisolidone 4'-O-Methyltectorigenin 5,7-Dihydroxy-6,4'-dimethoxyisoflavone |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
2345-17-7 |
| C_ID |
C00002540
, 
|
| InChIKey |
VOOFPOMXNLNEOF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)c(OC)c(O)c3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pericopsis laxiflora  | Ref. |
| Plantae | Fabaceae | Pericopsis mooniana | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris japonica  | Ref. |
| Plantae | Iridaceae | Iris kashmiriana | Ref. |
| Plantae | Iridaceae | Iris nepalensis  | Ref. |
| Plantae | Iridaceae | Iris tingitana | Ref. |
|
|
zoom in
| Organism | Iris kashmiriana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dhar,Indian Chem.Soc.,52,(1975),784
Prakash,J.Org.Chem.30,(1965),3561 |
|---|
|