| Name |
Acronycidine 5,7,8-Trimethoxydictamnine |
| Formula |
C15H15NO5 |
| Mw |
289.0950226 |
| CAS RN |
521-43-7 |
| C_ID |
C00002129
, 
|
| InChIKey |
XTCGYRFLVLFRGW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H15NO5/c1-17-9-7-10(18-2)14(20-4)12-11(9)13(19-3)8-5-6-21-15(8)16-12/h5-7H,1-4H3 |
| SMILES |
COc1cc(OC)c2c(OC)c3ccoc3nc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Acronychia baueri | Ref. |
| Plantae | Rutaceae | Bauerella simplicifolia ssp.neo-scotica | Ref. |
| Plantae | Rutaceae | Medicosma subsessilis | Ref. |
| Plantae | Rutaceae | Melicope fareana | Ref. |
| Plantae | Rutaceae | Melicope foreana | Ref. |
| Plantae | Rutaceae | Melicope leptococa | Ref. |
| Plantae | Rutaceae | Melicope leptococca | Ref. |
| Plantae | Rutaceae | Sarcomelicope argyrophylla | Ref. |
| Plantae | Rutaceae | Sarcomelicope leicarpa | Ref. |
| Plantae | Rutaceae | Sarcomelicope leiocarpa | Ref. |
| Plantae | Rutaceae | Sarcomelicope megistophylla | Ref. |
|
|
zoom in
| Organism | Sarcomelicope megistophylla | | Reference | FOKIALAKIS, et al., Chem Pharm Bull, 50, (2002), 413.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|