| Name |
Lycoflexine Lycobergine |
| Formula |
C17H25NO2 |
| Mw |
275.18852905 |
| CAS RN |
52485-00-4 |
| C_ID |
C00001946
, 
|
| InChIKey |
SJIMDGIDDDGXLI-RUBTYCQZNA-N |
| InChICode |
InChI=1S/C17H25NO2/c1-12-8-13-10-14(19)16-4-2-6-18(11-16)7-3-5-17(13,16)15(20)9-12/h12-13H,2-11H2,1H3/t12-,13+,16+,17-/m1/s1 |
| SMILES |
C[C@H]1CC(=O)[C@]23CCC[N@]4CCC[C@]2(C4)C(=O)C[C@@H]3C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium carolinianum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium clavatum var. borbonicum  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium clavatum var. inflexum  | Ref. |
| Plantae | Lycopodiaceae | Lycopodium deuterodensum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium fastigiatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium inundatum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium phlegmaria | Ref. |
| Plantae | Lycopodiaceae | Lycopodium serratum | Ref. |
| Plantae | Lycopodiaceae | Lycopodium serratum var. serratum f. intermedium | Ref. |
| Plantae | Lycopodiaceae | Lycopodium serratum var. serratum f. serratum | Ref. |
| Plantae | Lycopodiaceae | Phlegmariurus phlegmaria | Ref. |
|
|
zoom in
| Organism | Phlegmariurus phlegmaria | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|