| Name |
Dihydrochrysin Pinocembrin |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
480-39-7 |
| C_ID |
C00000992
, 
|
| InChIKey |
URFCJEUYXNAHFI-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2/t13-/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccccc2)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Annonaceae | Goniothalamus griffithii | Ref. |
| Plantae | Annonaceae | Uvaria chamae  | Ref. |
| Plantae | Asteraceae | Flourensia hirsuta | Ref. |
| Plantae | Asteraceae | Flourensia ilicifolia | Ref. |
| Plantae | Asteraceae | Flourensia retinophylla | Ref. |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Phonus arborescens | Ref. |
| Plantae | Betulaceae | Alnus spp. | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Combretaceae | Combretum albopunctatum Suesseng | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Lauraceae | Litsea glaucescens | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Pinaceae | Pinus cembra  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Piperaceae | Piper gaudichaudianum | Ref. |
| Plantae | Piperaceae | Piper hostmannianum | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Alnus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 229,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),129
Wollenweber,Phytochem.,10,(1971),225 |
|---|
|