| Name |
Phloridzin Phloretin 2'-glucoside Phlorizin |
| Formula |
C21H24O10 |
| Mw |
436.13694699 |
| CAS RN |
60-81-1 |
| C_ID |
C00000990
, 
|
| InChIKey |
IOUVKUPGCMBWBT-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H24O10/c22-9-16-18(27)19(28)20(29)21(31-16)30-15-8-12(24)7-14(26)17(15)13(25)6-3-10-1-4-11(23)5-2-10/h1-2,4-5,7-8,16,18-24,26-29H,3,6,9H2/t16-,18+,19-,20-,21+/m0/s1 |
| SMILES |
O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Ericaceae | Kalmia latifolia  | Ref. |
| Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
| Plantae | Ericaceae | Pieris japonica  | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Fabaceae | Flemingia strobilifera  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Lithocarpus liseifolius | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Malus domestica  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Sapindaceae | Litchi chinensis  | Ref. |
| Plantae | Saxifragaceae | Lithophragma affine | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Symplocaceae | Symplocos lancifolia | Ref. |
| Plantae | Symplocaceae | Symplocos spicata | Ref. |
|
|
zoom in
| Organism | Lithocarpus liseifolius | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Williams,Nature,202,(1964),824 |
|---|
|