| Name |
Vitisinol C |
| Formula |
C27H24O5 |
| Mw |
428.16237388 |
| CAS RN |
848985-81-9 |
| C_ID |
C00064573
|
| InChIKey |
BSKGJESYXYEJPI-XYVLITODSA-N |
| InChICode |
InChI=1S/C27H24O5/c28-21-7-3-17(4-8-21)1-2-18-11-23(30)16-27(19-5-9-22(29)10-6-19)26(12-18)20-13-24(31)15-25(32)14-20/h1-11,13-15,26-29,31-32H,12,16H2/b2-1+/t26-,27-/m0/s1 |
| SMILES |
O=C1C=C(C=Cc2ccc(O)cc2)CC(c2cc(O)cc(O)c2)C(c2ccc(O)cc2)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis davidii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|