| Name |
beta-Hydroxyisovalerylshikonin |
| Formula |
C21H24O7 |
| Mw |
388.15220312 |
| CAS RN |
7415-78-3 |
| C_ID |
C00064517
|
| InChIKey |
|
| InChICode |
InChI=1S/C21H24O7/c1-11(2)5-8-16(28-17(25)10-21(3,4)27)12-9-15(24)18-13(22)6-7-14(23)19(18)20(12)26/h5-7,9,16,22-23,27H,8,10H2,1-4H3;InChI=1S/C21H24O7/c1-11(2)5-8-16(28-17(25)10-21(3,4)27)12-9-15(24)18-13(22)6-7-14(23)19(18)20(12)26/h5-7,9,16,22-23,27H,8,10H2,1-4H3/t16-/m1/s1 |
| SMILES |
CC(C)=CCC(OC(=O)CC(C)(C)O)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Boraginaceae | Arnebia guttata | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon | Ref. |
|
|
zoom in
| Organism | Arnebia guttata |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
