| Name |
Lawsonadeem |
| Formula |
C22H12O6 |
| Mw |
372.06338812 |
| CAS RN |
632337-75-8 |
| C_ID |
C00064454
|
| InChIKey |
ZZJWLRVETORBDG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H12O6/c1-27-15-8-4-7-12-16(15)18(24)14-9-13-17(23)10-5-2-3-6-11(10)19(25)21(13)28-22(14)20(12)26/h2-8H,9H2,1H3 |
| SMILES |
COc1cccc2c1C(=O)C1=C(OC3=C(C1)C(=O)c1ccccc1C3=O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
