| Name |
Oxomatairesinol |
| Formula |
C20H20O7 |
| Mw |
372.12090299 |
| CAS RN |
53250-61-6 |
| C_ID |
C00064383
|
| InChIKey |
VBBXDTGECAKSAY-KGLIPLIRSA-N |
| InChICode |
InChI=1S/C20H20O7/c1-25-17-8-11(3-5-15(17)21)7-13-14(10-27-20(13)24)19(23)12-4-6-16(22)18(9-12)26-2/h3-6,8-9,13-14,21-22H,7,10H2,1-2H3/t13-,14+/m1/s1 |
| SMILES |
COc1cc(CC2C(=O)OCC2C(=O)c2ccc(O)c(OC)c2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
|
|
zoom in
| Organism | Taxus wallichiana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|