| Name |
beta-Sorigenin |
| Formula |
C12H8O4 |
| Mw |
216.04225874 |
| CAS RN |
492-23-9 |
| C_ID |
C00064356
|
| InChIKey |
JDGOEFZZYBWLFE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H8O4/c13-8-3-1-2-6-4-7-5-16-12(15)10(7)11(14)9(6)8/h1-4,13-14H,5H2 |
| SMILES |
O=C1OCc2cc3cccc(O)c3c(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Rhamnus prinoides  | Ref. |
| Plantae | Rhamnaceae | Rhamnus wightii  | Ref. |
|
|
zoom in
| Organism | Rhamnus wightii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|