| Name |
beta-Truxilline |
| Formula |
C38H46N2O8 |
| Mw |
658.32541646 |
| CAS RN |
490-15-3 |
| C_ID |
C00064354
|
| InChIKey |
SYSWFFZJNZSEIZ-FGABBBEOSA-N |
| InChICode |
InChI=1S/C38H46N2O8/c1-39-23-15-17-25(39)31(35(41)45-3)27(19-23)47-37(43)33-29(21-11-7-5-8-12-21)30(22-13-9-6-10-14-22)34(33)38(44)48-28-20-24-16-18-26(40(24)2)32(28)36(42)46-4/h5-14,23-34H,15-20H2,1-4H3/t23-,24-,25+,26+,27-,28-,29-,30+,31+,32+,33+,34-/m0/s1 |
| SMILES |
COC(=O)C1C(OC(=O)C2C(C(=O)OC3CC4CCC(C3C(=O)OC)N4C)C(c3ccccc3)C2c2ccccc2)CC2CCC1N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|