| Name |
Decumbic acid |
| Formula |
C9H12O4 |
| Mw |
184.07355887 |
| CAS RN |
390401-25-9 |
| C_ID |
C00064316
|
| InChIKey |
GMDXRLRSQUTZAT-ZCFIWIBFSA-N |
| InChICode |
InChI=1S/C9H12O4/c1-3-4-6-7(8(10)11)5(2)9(12)13-6/h6H,3-4H2,1-2H3,(H,10,11)/t6-/m1/s1 |
| SMILES |
CCCC1OC(=O)C(C)=C1C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|