| Name |
Emodin-6-O-beta-D-glucopyranoside Emodin glucoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
34298-85-6 |
| C_ID |
C00064292
|
| InChIKey |
UBVJENDWBOVRBS-FHTSYUTFSA-N |
| InChICode |
InChI=1S/C21H20O10/c1-7-2-9-14(11(23)3-7)18(27)15-10(16(9)25)4-8(5-12(15)24)30-21-20(29)19(28)17(26)13(6-22)31-21/h2-5,13,17,19-24,26,28-29H,6H2,1H3/t13-,17+,19+,20-,21+/m1/s1 |
| SMILES |
Cc1cc(O)c2c(c1)C(=O)c1cc(OC3OC(CO)C(O)C(O)C3O)cc(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
|
|
zoom in
| Organism | Polygonum sachalinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|