| Name |
Rumexoside |
| Formula |
C20H22O10 |
| Mw |
422.12129692 |
| CAS RN |
339165-11-6 |
| C_ID |
C00064287
|
| InChIKey |
GPYNRGVKMWCYIE-DIKOWXHZSA-N |
| InChICode |
InChI=1S/C20H22O10/c1-7-3-9-4-10(19(27)28)5-11(14(9)16(24)13(7)8(2)22)29-20-18(26)17(25)15(23)12(6-21)30-20/h3-5,12,15,17-18,20-21,23-26H,6H2,1-2H3,(H,27,28)/t12-,15-,17+,18-,20-/m1/s1 |
| SMILES |
CC(=O)c1c(C)cc2cc(C(=O)O)cc(OC3OC(CO)C(O)C(O)C3O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Polygonaceae | Rumex patientia  | Ref. |
|
|
zoom in
| Organism | Rumex patientia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|