| Name |
Pallidol 3-O-glucoside |
| Formula |
C34H32O11 |
| Mw |
616.19446187 |
| CAS RN |
285568-84-5 |
| C_ID |
C00064254
|
| InChIKey |
LVYZAJNLNYSPIX-DWSCVXMCSA-N |
| InChICode |
InChI=1S/C34H32O11/c35-13-24-31(41)32(42)33(43)34(45-24)44-19-11-21-28(23(40)12-19)26(15-3-7-17(37)8-4-15)29-20-9-18(38)10-22(39)27(20)25(30(21)29)14-1-5-16(36)6-2-14/h1-12,24-26,29-43H,13H2/t24-,25-,26-,29+,30+,31-,32+,33-,34-/m1/s1 |
| SMILES |
OCC1OC(Oc2cc(O)c3c(c2)C2C(c4ccc(O)cc4)c4c(O)cc(O)cc4C2C3c2ccc(O)cc2)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis labrusca | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|