| Name |
Anadoline |
| Formula |
C20H31NO7 |
| Mw |
397.21005235 |
| CAS RN |
28513-29-3 |
| C_ID |
C00064253
|
| InChIKey |
|
| InChICode |
InChI=1S/C20H31NO7/c1-5-12(2)19(24)27-10-13(3)18(23)14(4)20(25)28-11-15-6-8-21(26)9-7-16(22)17(15)21/h5-6,13-14,16-18,22-23H,7-11H2,1-4H3/b12-5+;InChI=1S/C20H31NO7/c1-5-12(2)19(24)27-10-13(3)18(23)14(4)20(25)28-11-15-6-8-21(26)9-7-16(22)17(15)21/h5-6,13-14,16-18,22-23H,7-11H2,1-4H3/b12-5+/t13?,14-,16-,17-,18+,21?/m1/s1 |
| SMILES |
CC=C(C)C(=O)OCC(C)C(O)C(C)C(=O)OCC1=CC[N+]2([O-])CCC(O)C12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Symphytum orientale | Ref. |
| Plantae | Boraginaceae | Symphytum tuberosum | Ref. |
|
|
zoom in
| Organism | Symphytum tuberosum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
