| Name |
Papraline |
| Formula |
C10H7NO2 |
| Mw |
173.04767848 |
| CAS RN |
269-44-3 |
| C_ID |
C00064241
|
| InChIKey |
DWFDGERFICTFQW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H7NO2/c1-2-11-5-8-4-10-9(3-7(1)8)12-6-13-10/h1-5H,6H2 |
| SMILES |
c1cc2cc3c(cc2cn1)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
|
|
zoom in
| Organism | Fumaria kralikii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|