| Name |
Achyranthine |
| Formula |
C6H11NO2 |
| Mw |
129.0789786 |
| CAS RN |
25712-60-1 |
| C_ID |
C00064226
|
| InChIKey |
LJGFIWDOHOWUOY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H11NO2/c1-7-3-2-5(4-7)6(8)9/h5H,2-4H2,1H3,(H,8,9) |
| SMILES |
CN1CCC(C(=O)O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Amaranthaceae | Achyranthes bidentata  | Ref. |
|
|
zoom in
| Organism | Achyranthes bidentata | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|