| Name |
d-alpha-Phellandrene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
2243-33-6 |
| C_ID |
C00064182
|
| InChIKey |
OGLDWXZKYODSOB-JTQLQIEISA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4-6,8,10H,7H2,1-3H3/t10-/m0/s1 |
| SMILES |
CC1=CCC(C(C)C)C=C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|