| Name |
6'-O-Coumaroylaloesin |
| Formula |
C28H28O11 |
| Mw |
540.16316174 |
| CAS RN |
2226510-60-5 |
| C_ID |
C00064177
|
| InChIKey |
NUYUUMDHHLBRHZ-HLSNPBEDSA-N |
| InChICode |
InChI=1S/C28H28O11/c1-13-9-18(31)23(27-22(13)19(32)11-17(38-27)10-14(2)29)28-26(36)25(35)24(34)20(39-28)12-37-21(33)8-5-15-3-6-16(30)7-4-15/h3-9,11,20,24-26,28,30-31,34-36H,10,12H2,1-2H3/t20-,24-,25+,26-,28+/m1/s1 |
| SMILES |
CC(=O)Cc1cc(=O)c2c(C)cc(O)c(C3OC(COC(=O)C=Cc4ccc(O)cc4)C(O)C(O)C3O)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe castanea | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
|
|
zoom in
| Organism | Aloe vera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|