| Name |
Flexuosol A |
| Formula |
C56H42O12 |
| Mw |
906.26762681 |
| CAS RN |
205440-11-5 |
| C_ID |
C00064134
|
| InChIKey |
GLQOGVYZTTVYKZ-NNJXGGENSA-N |
| InChICode |
InChI=1S/C56H42O12/c57-34-10-1-28(2-11-34)3-18-43-50-46(67-54(29-4-12-35(58)13-5-29)48(50)32-19-38(61)23-39(62)20-32)27-47-51(43)53(56(68-47)31-8-16-37(60)17-9-31)44-25-42(65)26-45-52(44)49(33-21-40(63)24-41(64)22-33)55(66-45)30-6-14-36(59)15-7-30/h1-27,48-49,53-65H/b18-3+/t48-,49-,53+,54+,55+,56-/m1/s1 |
| SMILES |
Oc1ccc(C=Cc2c3c(cc4c2C(c2cc(O)cc5c2C(c2cc(O)cc(O)c2)C(c2ccc(O)cc2)O5)C(c2ccc(O)cc2)O4)OC(c2ccc(O)cc2)C3c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis flexuosa | Ref. |
| Plantae | Vitaceae | Vitis wilsoniae | Ref. |
|
|
zoom in
| Organism | Vitis wilsoniae | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|