| Name |
Koelzioside |
| Formula |
C41H46O17 |
| Mw |
810.27350005 |
| CAS RN |
141968-12-9 |
| C_ID |
C00063859
|
| InChIKey |
NKORFEGGMJANHB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C41H46O17/c1-21-33(52-22(2)44)35(54-27(45)15-13-23-9-5-3-6-10-23)36(55-28(46)16-14-24-11-7-4-8-12-24)40(51-21)56-34-25-17-18-50-38(29(25)41(20-43)37(34)58-41)57-39-32(49)31(48)30(47)26(19-42)53-39/h3-18,21,25-26,29-40,42-43,47-49H,19-20H2,1-2H3 |
| SMILES |
CC(=O)OC1C(C)OC(OC2C3C=COC(OC4OC(CO)C(O)C(O)C4O)C3C3(CO)OC23)C(OC(=O)C=Cc2ccccc2)C1OC(=O)C=Cc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia deserti  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
|
|
zoom in
| Organism | Scrophularia lepidota | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|