| Name |
Hydrangenone |
| Formula |
C30H42O5 |
| Mw |
482.30322445 |
| CAS RN |
1351991-83-7 |
| C_ID |
C00063815
|
| InChIKey |
NLYPIHUEOMJFBW-KERNGSKHSA-N |
| InChICode |
InChI=1S/C30H42O5/c1-16(2)21-22(32)26-12-9-19-24(4,5)10-8-11-27(19)15-29(26)28(33,18(13-26)17(3)31)14-20-25(6,7)34-23(21)30(20,29)35-27/h16,18-20,33H,8-15H2,1-7H3/t18-,19-,20+,26-,27-,28+,29+,30-/m0/s1 |
| SMILES |
CC(=O)C1CC23CCC4C(C)(C)CCCC45CC24C1(O)CC1C(C)(C)OC(=C(C(C)C)C3=O)C14O5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia eremophila | Ref. |
| Plantae | Labiatae | Salvia hydrangea | Ref. |
|
|
zoom in
| Organism | Salvia hydrangea | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|