| Name |
Marumoside A |
| Formula |
C14H19NO6 |
| Mw |
297.12123735 |
| CAS RN |
1309604-34-9 |
| C_ID |
C00063770
|
| InChIKey |
FBANEUHXMFEIRO-WBFOWJMUSA-N |
| InChICode |
InChI=1S/C14H19NO6/c1-7-11(17)12(18)13(19)14(20-7)21-9-4-2-8(3-5-9)6-10(15)16/h2-5,7,11-14,17-19H,6H2,1H3,(H2,15,16)/t7-,11-,12+,13+,14-/m0/s1 |
| SMILES |
CC1OC(Oc2ccc(CC(N)=O)cc2)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa peregrine | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|