| Name |
Rabaichromone |
| Formula |
C29H32O12 |
| Mw |
572.18937649 |
| CAS RN |
126199-34-6 |
| C_ID |
C00063747
|
| InChIKey |
DWFAOPWLORYRCM-IZZWGAOPSA-N |
| InChICode |
InChI=1S/C29H32O12/c1-13-8-20(38-3)24(27-23(13)19(34)11-16(39-27)9-14(2)31)28-29(26(37)25(36)21(12-30)40-28)41-22(35)7-5-15-4-6-17(32)18(33)10-15/h4-8,10-11,14,21,25-26,28-33,36-37H,9,12H2,1-3H3/b7-5+/t14-,21-,25-,26+,28+,29-/m1/s1 |
| SMILES |
COc1cc(C)c2c(=O)cc(CC(C)O)oc2c1C1OC(CO)C(O)C(O)C1OC(=O)C=Cc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe rabaiensis  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
|
|
zoom in
| Organism | Aloe vera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|